C10H10ClN3O4S — CID 154108236
7-chloro-2-(hydroxymethyl)-3-methyl-4-oxoquinazoline-6-sulfonamide (PubChem CID 154108236) has the molecular formula C10H10ClN3O4S and a molecular weight of 303.73 g/mol. Its IUPAC name is 7-chloro-2-(hydroxymethyl)-3-methyl-4-oxoquinazoline-6-sulfonamide.
| Compound Name | 7-chloro-2-(hydroxymethyl)-3-methyl-4-oxoquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 154108236 |
| Molecular Formula | C10H10ClN3O4S |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 7-chloro-2-(hydroxymethyl)-3-methyl-4-oxoquinazoline-6-sulfonamide |
| SMILES | Cn1c(CO)nc2cc(Cl)c(S(N)(=O)=O)cc2c1=O |
| InChI | InChI=1S/C10H10ClN3O4S/c1-14-9(4-15)13-7-3-6(11)8(19(12,17)18)2-5(7)10(14)16/h2-3,15H,4H2,1H3,(H2,12,17,18) |
| InChIKey | XGVXPTRBUUGREV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |