C16H18Cl2N4O2 — CID 154114709
6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine (PubChem CID 154114709) has the molecular formula C16H18Cl2N4O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine.
| Compound Name | 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine |
|---|---|
| PubChem CID | 154114709 |
| Molecular Formula | C16H18Cl2N4O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine |
| SMILES | [H]/N=c1\nc(Oc2ccc(Cl)cc2Cl)c(CC=CCCC)c(N)n1O |
| InChI | InChI=1S/C16H18Cl2N4O2/c1-2-3-4-5-6-11-14(19)22(23)16(20)21-15(11)24-13-8-7-10(17)9-12(13)18/h4-5,7-9,20,23H,2-3,6,19H2,1H3/b5-4?,20-16+ |
| InChIKey | PHNIEUGUFHLOEK-OZUUGHPTSA-N |
| XLogP | 4.18 |
| TPSA | 97.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|