About 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine
6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine (PubChem CID 154114709) has the molecular formula C16H18Cl2N4O2
and a molecular weight of 369.25 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine |
| PubChem CID | 154114709 |
| Molecular Formula | C16H18Cl2N4O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine |
| SMILES | [H]/N=c1\nc(Oc2ccc(Cl)cc2Cl)c(CC=CCCC)c(N)n1O |
| InChI | InChI=1S/C16H18Cl2N4O2/c1-2-3-4-5-6-11-14(19)22(23)16(20)21-15(11)24-13-8-7-10(17)9-12(13)18/h4-5,7-9,20,23H,2-3,6,19H2,1H3/b5-4?,20-16+ |
| InChIKey | PHNIEUGUFHLOEK-OZUUGHPTSA-N |
| XLogP | 4.18 |
| TPSA | 97.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine?
The IUPAC name of 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine (CID 154114709) is 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine.
What is the SMILES notation for 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine?
The canonical SMILES for 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine is [H]/N=c1\nc(Oc2ccc(Cl)cc2Cl)c(CC=CCCC)c(N)n1O.
What is the InChIKey of 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine?
The InChIKey is PHNIEUGUFHLOEK-OZUUGHPTSA-N. The full InChI is InChI=1S/C16H18Cl2N4O2/c1-2-3-4-5-6-11-14(19)22(23)16(20)21-15(11)24-13-8-7-10(17)9-12(13)18/h4-5,7-9,20,23H,2-3,6,19H2,1H3/b5-4?,20-16+.
What are the key properties of 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine?
6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine has a molecular weight of 369.25 g/mol, XLogP of 4.18, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine is sourced from PubChem (CID 154114709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).