C10H7Cl2N3O2 — CID 56998483
4-(2,4-dichlorophenoxy)-1-hydroxypyrimidin-2-imine (PubChem CID 56998483) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-hydroxypyrimidin-2-imine.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-hydroxypyrimidin-2-imine |
|---|---|
| PubChem CID | 56998483 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-hydroxypyrimidin-2-imine |
| SMILES | [H]/N=c1\nc(Oc2ccc(Cl)cc2Cl)ccn1O |
| InChI | InChI=1S/C10H7Cl2N3O2/c11-6-1-2-8(7(12)5-6)17-9-3-4-15(16)10(13)14-9/h1-5,13,16H/b13-10+ |
| InChIKey | FRSLKFFPWYLBHU-JLHYYAGUSA-N |
| XLogP | 2.70 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|