C11H9Cl2N3O2 — CID 154088620
6-(2,4-dichlorophenoxy)-3-hydroxy-2-methylpyrimidin-4-imine (PubChem CID 154088620) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-3-hydroxy-2-methylpyrimidin-4-imine.
| Compound Name | 6-(2,4-dichlorophenoxy)-3-hydroxy-2-methylpyrimidin-4-imine |
|---|---|
| PubChem CID | 154088620 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-3-hydroxy-2-methylpyrimidin-4-imine |
| SMILES | [H]/N=c1\cc(Oc2ccc(Cl)cc2Cl)nc(C)n1O |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-6-15-11(5-10(14)16(6)17)18-9-3-2-7(12)4-8(9)13/h2-5,14,17H,1H3/b14-10+ |
| InChIKey | CJOFNNMLMLLMBR-GXDHUFHOSA-N |
| XLogP | 3.01 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|