C14H19ClN2 — CID 154119906
6-chloro-3-cyclohexyl-2,4-dihydro-1H-quinazoline (PubChem CID 154119906) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 6-chloro-3-cyclohexyl-2,4-dihydro-1H-quinazoline.
| Compound Name | 6-chloro-3-cyclohexyl-2,4-dihydro-1H-quinazoline |
|---|---|
| PubChem CID | 154119906 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 6-chloro-3-cyclohexyl-2,4-dihydro-1H-quinazoline |
| SMILES | Clc1ccc2c(c1)CN(C1CCCCC1)CN2 |
| InChI | InChI=1S/C14H19ClN2/c15-12-6-7-14-11(8-12)9-17(10-16-14)13-4-2-1-3-5-13/h6-8,13,16H,1-5,9-10H2 |
| InChIKey | UZVFOBCSRACABZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |