C19H19ClN2 — CID 154121604
10-chloro-4-ethyl-13-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene (PubChem CID 154121604) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 10-chloro-4-ethyl-13-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene.
| Compound Name | 10-chloro-4-ethyl-13-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene |
|---|---|
| PubChem CID | 154121604 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 10-chloro-4-ethyl-13-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene |
| SMILES | CCN1CC2=C(C1)c1ccc(Cl)cc1N(C)c1ccccc12 |
| InChI | InChI=1S/C19H19ClN2/c1-3-22-11-16-14-6-4-5-7-18(14)21(2)19-10-13(20)8-9-15(19)17(16)12-22/h4-10H,3,11-12H2,1-2H3 |
| InChIKey | JWBCNYAOMRYQIB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|