C10H20O4 — CID 154128100
2-(1,2-diethoxy-2-methoxyethenoxy)propane (PubChem CID 154128100) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(1,2-diethoxy-2-methoxyethenoxy)propane.
| Compound Name | 2-(1,2-diethoxy-2-methoxyethenoxy)propane |
|---|---|
| PubChem CID | 154128100 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-(1,2-diethoxy-2-methoxyethenoxy)propane |
| SMILES | CCOC(OC)=C(OCC)OC(C)C |
| InChI | InChI=1S/C10H20O4/c1-6-12-9(11-5)10(13-7-2)14-8(3)4/h8H,6-7H2,1-5H3 |
| InChIKey | DJLHFJRKQAOHSP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|