C12H24O4 — CID 163217034
1,1,2,3-tetraethoxybut-1-ene (PubChem CID 163217034) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1,1,2,3-tetraethoxybut-1-ene.
| Compound Name | 1,1,2,3-tetraethoxybut-1-ene |
|---|---|
| PubChem CID | 163217034 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1,1,2,3-tetraethoxybut-1-ene |
| SMILES | CCOC(OCC)=C(OCC)C(C)OCC |
| InChI | InChI=1S/C12H24O4/c1-6-13-10(5)11(14-7-2)12(15-8-3)16-9-4/h10H,6-9H2,1-5H3 |
| InChIKey | ZDQALYNFCPTYMM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|