C17H18N2O2 — CID 154131072
1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl(furan-2-yl)methanone (PubChem CID 154131072) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl(furan-2-yl)methanone.
| Compound Name | 1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl(furan-2-yl)methanone |
|---|---|
| PubChem CID | 154131072 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN2c3ccccc3CCC2C1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(16-6-3-11-21-16)18-9-10-19-14(12-18)8-7-13-4-1-2-5-15(13)19/h1-6,11,14H,7-10,12H2 |
| InChIKey | SEGQXSVTXMMYNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |