C23H27N3O3 — CID 136543800
1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indol-2-yl-[1-(furan-2-carbonyl)piperidin-2-yl]methanone (PubChem CID 136543800) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indol-2-yl-[1-(furan-2-carbonyl)piperidin-2-yl]methanone.
| Compound Name | 1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indol-2-yl-[1-(furan-2-carbonyl)piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 136543800 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indol-2-yl-[1-(furan-2-carbonyl)piperidin-2-yl]methanone |
| SMILES | O=C(C1CCCCN1C(=O)c1ccco1)N1CCCN2c3ccccc3CC2C1 |
| InChI | InChI=1S/C23H27N3O3/c27-22(20-9-3-4-12-26(20)23(28)21-10-5-14-29-21)24-11-6-13-25-18(16-24)15-17-7-1-2-8-19(17)25/h1-2,5,7-8,10,14,18,20H,3-4,6,9,11-13,15-16H2 |
| InChIKey | HQMYROAWIAOIMB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |