About 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium
2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium (PubChem CID 15413161) has the molecular formula C14H22ClNO7S
and a molecular weight of 383.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium |
| PubChem CID | 15413161 |
| Molecular Formula | C14H22ClNO7S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium |
| SMILES | O=C([O-])CS(=O)(=O)c1ccc(Cl)cc1.OCC[NH+](CCO)CCO |
| InChI | InChI=1S/C8H7ClO4S.C6H15NO3/c9-6-1-3-7(4-2-6)14(12,13)5-8(10)11;8-4-1-7(2-5-9)3-6-10/h1-4H,5H2,(H,10,11);8-10H,1-6H2 |
| InChIKey | JOFJRFDUTKHYFY-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium?
The IUPAC name of 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium (CID 15413161) is 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium.
What is the SMILES notation for 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium?
The canonical SMILES for 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium is O=C([O-])CS(=O)(=O)c1ccc(Cl)cc1.OCC[NH+](CCO)CCO.
What is the InChIKey of 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium?
The InChIKey is JOFJRFDUTKHYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO4S.C6H15NO3/c9-6-1-3-7(4-2-6)14(12,13)5-8(10)11;8-4-1-7(2-5-9)3-6-10/h1-4H,5H2,(H,10,11);8-10H,1-6H2.
What are the key properties of 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium?
2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium has a molecular weight of 383.85 g/mol, XLogP of -3.29, 9 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)sulfonylacetate;tris(2-hydroxyethyl)azanium is sourced from PubChem (CID 15413161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).