About 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine
3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine (PubChem CID 15413212) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine.
Analyze 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The IUPAC name of 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine (CID 15413212) is 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine.
What is the SMILES notation for 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The canonical SMILES for 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine is Cc1[nH]n2c(C)nnc2c1N.
What is the InChIKey of 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
The InChIKey is CDOXXCCESYGPRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c1-3-5(7)6-9-8-4(2)11(6)10-3/h10H,7H2,1-2H3.
What are the key properties of 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine?
3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine has a molecular weight of 151.17 g/mol, XLogP of 0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-amine is sourced from PubChem (CID 15413212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).