C9H24N6 — CID 154133336
2,4,6-triethyl-1,3,5-triazinane-2,4,6-triamine (PubChem CID 154133336) has the molecular formula C9H24N6 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,4,6-triethyl-1,3,5-triazinane-2,4,6-triamine.
| Compound Name | 2,4,6-triethyl-1,3,5-triazinane-2,4,6-triamine |
|---|---|
| PubChem CID | 154133336 |
| Molecular Formula | C9H24N6 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2,4,6-triethyl-1,3,5-triazinane-2,4,6-triamine |
| SMILES | CCC1(N)NC(N)(CC)NC(N)(CC)N1 |
| InChI | InChI=1S/C9H24N6/c1-4-7(10)13-8(11,5-2)15-9(12,6-3)14-7/h13-15H,4-6,10-12H2,1-3H3 |
| InChIKey | VNXAQRDFTMXLOF-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |