C27H48N2 — CID 69338032
3-ethyl-5,7-dimethyladamantan-1-amine;3,5,7-trimethyladamantan-1-amine (PubChem CID 69338032) has the molecular formula C27H48N2 and a molecular weight of 400.70 g/mol. Its IUPAC name is 3-ethyl-5,7-dimethyladamantan-1-amine;3,5,7-trimethyladamantan-1-amine.
| Compound Name | 3-ethyl-5,7-dimethyladamantan-1-amine;3,5,7-trimethyladamantan-1-amine |
|---|---|
| PubChem CID | 69338032 |
| Molecular Formula | C27H48N2 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 400.38 |
| IUPAC Name | 3-ethyl-5,7-dimethyladamantan-1-amine;3,5,7-trimethyladamantan-1-amine |
| SMILES | CC12CC3(C)CC(C)(C1)CC(N)(C2)C3.CCC12CC3(C)CC(C)(CC(N)(C3)C1)C2 |
| InChI | InChI=1S/C14H25N.C13H23N/c1-4-13-6-11(2)5-12(3,7-13)9-14(15,8-11)10-13;1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11/h4-10,15H2,1-3H3;4-9,14H2,1-3H3 |
| InChIKey | SWWOUAHNTFJPFS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |