C5H12N4 — CID 142854810
3-ethyl-1,2-dihydropyrazole-3,5-diamine (PubChem CID 142854810) has the molecular formula C5H12N4 and a molecular weight of 128.18 g/mol. Its IUPAC name is 3-ethyl-1,2-dihydropyrazole-3,5-diamine.
| Compound Name | 3-ethyl-1,2-dihydropyrazole-3,5-diamine |
|---|---|
| PubChem CID | 142854810 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 3-ethyl-1,2-dihydropyrazole-3,5-diamine |
| SMILES | CCC1(N)C=C(N)NN1 |
| InChI | InChI=1S/C5H12N4/c1-2-5(7)3-4(6)8-9-5/h3,8-9H,2,6-7H2,1H3 |
| InChIKey | IBFIYQYKVMJVDV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |