C5H11N3 — CID 86340976
3-ethyl-2,3-dihydro-1H-pyrazol-5-amine (PubChem CID 86340976) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydro-1H-pyrazol-5-amine.
| Compound Name | 3-ethyl-2,3-dihydro-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 86340976 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 3-ethyl-2,3-dihydro-1H-pyrazol-5-amine |
| SMILES | CCC1C=C(N)NN1 |
| InChI | InChI=1S/C5H11N3/c1-2-4-3-5(6)8-7-4/h3-4,7-8H,2,6H2,1H3 |
| InChIKey | BIDQCVCYABRFMZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |