About 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine
4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine (PubChem CID 86340495) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine.
Analyze 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine?
The IUPAC name of 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine (CID 86340495) is 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine.
What is the SMILES notation for 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine?
The canonical SMILES for 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine is CCC1=C(N)NNC1C.
What is the InChIKey of 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine?
The InChIKey is JOOVDYCKCAMRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-3-5-4(2)8-9-6(5)7/h4,8-9H,3,7H2,1-2H3.
What are the key properties of 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine?
4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine has a molecular weight of 127.19 g/mol, XLogP of 0.06, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-methyl-2,3-dihydro-1H-pyrazol-5-amine is sourced from PubChem (CID 86340495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).