C9H15N — CID 167080953
2,5-diethyl-1,2-dihydropyridine (PubChem CID 167080953) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 2,5-diethyl-1,2-dihydropyridine.
| Compound Name | 2,5-diethyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 167080953 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2,5-diethyl-1,2-dihydropyridine |
| SMILES | CCC1=CNC(CC)C=C1 |
| InChI | InChI=1S/C9H15N/c1-3-8-5-6-9(4-2)10-7-8/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | QWAZNNLJVINOIV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |