C12H16O3 — CID 154136374
4,4-dimethoxy-1-phenylbutan-2-one (PubChem CID 154136374) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4,4-dimethoxy-1-phenylbutan-2-one.
| Compound Name | 4,4-dimethoxy-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 154136374 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4,4-dimethoxy-1-phenylbutan-2-one |
| SMILES | COC(CC(=O)Cc1ccccc1)OC |
| InChI | InChI=1S/C12H16O3/c1-14-12(15-2)9-11(13)8-10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3 |
| InChIKey | UWPCPWDBDUECHA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|