C16H38O4S3Si2 — CID 154139197
[6-[(6,6-dimethoxy-5-silylhexyl)trisulfanyl]-1,1-dimethoxyhexan-2-yl]silane (PubChem CID 154139197) has the molecular formula C16H38O4S3Si2 and a molecular weight of 446.85 g/mol. Its IUPAC name is [6-[(6,6-dimethoxy-5-silylhexyl)trisulfanyl]-1,1-dimethoxyhexan-2-yl]silane.
| Compound Name | [6-[(6,6-dimethoxy-5-silylhexyl)trisulfanyl]-1,1-dimethoxyhexan-2-yl]silane |
|---|---|
| PubChem CID | 154139197 |
| Molecular Formula | C16H38O4S3Si2 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [6-[(6,6-dimethoxy-5-silylhexyl)trisulfanyl]-1,1-dimethoxyhexan-2-yl]silane |
| SMILES | COC(OC)C([SiH3])CCCCSSSCCCCC([SiH3])C(OC)OC |
| InChI | InChI=1S/C16H38O4S3Si2/c1-17-15(18-2)13(24)9-5-7-11-21-23-22-12-8-6-10-14(25)16(19-3)20-4/h13-16H,5-12H2,1-4,24-25H3 |
| InChIKey | GIJLCCLARGQYNY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|