C15H37NO4Si2 — CID 175802360
N-(5,5-dimethoxy-4-silylpentyl)-5,5-dimethoxy-N-methyl-4-silylpentan-1-amine (PubChem CID 175802360) has the molecular formula C15H37NO4Si2 and a molecular weight of 351.64 g/mol. Its IUPAC name is N-(5,5-dimethoxy-4-silylpentyl)-5,5-dimethoxy-N-methyl-4-silylpentan-1-amine.
| Compound Name | N-(5,5-dimethoxy-4-silylpentyl)-5,5-dimethoxy-N-methyl-4-silylpentan-1-amine |
|---|---|
| PubChem CID | 175802360 |
| Molecular Formula | C15H37NO4Si2 |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-(5,5-dimethoxy-4-silylpentyl)-5,5-dimethoxy-N-methyl-4-silylpentan-1-amine |
| SMILES | COC(OC)C([SiH3])CCCN(C)CCCC([SiH3])C(OC)OC |
| InChI | InChI=1S/C15H37NO4Si2/c1-16(10-6-8-12(21)14(17-2)18-3)11-7-9-13(22)15(19-4)20-5/h12-15H,6-11H2,1-5,21-22H3 |
| InChIKey | FMKVFEBXYNLREI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|