C11H24BrNO — CID 83168230
N-(2-bromo-3-methoxypropyl)-N,4-dimethylpentan-1-amine (PubChem CID 83168230) has the molecular formula C11H24BrNO and a molecular weight of 266.22 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N,4-dimethylpentan-1-amine.
| Compound Name | N-(2-bromo-3-methoxypropyl)-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 83168230 |
| Molecular Formula | C11H24BrNO |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N,4-dimethylpentan-1-amine |
| SMILES | COCC(Br)CN(C)CCCC(C)C |
| InChI | InChI=1S/C11H24BrNO/c1-10(2)6-5-7-13(3)8-11(12)9-14-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | GVJRKKJNTUBIPO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|