C20H46O4S2Si2 — CID 123596896
4,4-dimethoxybutyl-[4-[4-(4,4-dimethoxybutylsilyl)butyldisulfanyl]butyl]silane (PubChem CID 123596896) has the molecular formula C20H46O4S2Si2 and a molecular weight of 470.89 g/mol. Its IUPAC name is 4,4-dimethoxybutyl-[4-[4-(4,4-dimethoxybutylsilyl)butyldisulfanyl]butyl]silane.
| Compound Name | 4,4-dimethoxybutyl-[4-[4-(4,4-dimethoxybutylsilyl)butyldisulfanyl]butyl]silane |
|---|---|
| PubChem CID | 123596896 |
| Molecular Formula | C20H46O4S2Si2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4,4-dimethoxybutyl-[4-[4-(4,4-dimethoxybutylsilyl)butyldisulfanyl]butyl]silane |
| SMILES | COC(CCC[SiH2]CCCCSSCCCC[SiH2]CCCC(OC)OC)OC |
| InChI | InChI=1S/C20H46O4S2Si2/c1-21-19(22-2)11-9-17-27-15-7-5-13-25-26-14-6-8-16-28-18-10-12-20(23-3)24-4/h19-20H,5-18,27-28H2,1-4H3 |
| InChIKey | AOGPAJALPJAEET-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|