C21H21N5O3S — CID 154143448
6-amino-3-(2,5-dimethylthiophen-3-yl)-N-morpholin-4-yl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide (PubChem CID 154143448) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 6-amino-3-(2,5-dimethylthiophen-3-yl)-N-morpholin-4-yl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide.
| Compound Name | 6-amino-3-(2,5-dimethylthiophen-3-yl)-N-morpholin-4-yl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 154143448 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 6-amino-3-(2,5-dimethylthiophen-3-yl)-N-morpholin-4-yl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide |
| SMILES | Cc1cc(-c2n[nH]c3c2C(=O)c2c-3ccc(N)c2C(=O)NN2CCOCC2)c(C)s1 |
| InChI | InChI=1S/C21H21N5O3S/c1-10-9-13(11(2)30-10)19-17-18(23-24-19)12-3-4-14(22)16(15(12)20(17)27)21(28)25-26-5-7-29-8-6-26/h3-4,9H,5-8,22H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | PYNSNQOLIJJHNW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|