C19H19N5O2S — CID 5330030
1-(dimethylamino)-3-[3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea (PubChem CID 5330030) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea.
| Compound Name | 1-(dimethylamino)-3-[3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 5330030 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-(dimethylamino)-3-[3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea |
| SMILES | Cc1cc(-c2n[nH]c3c2C(=O)c2c(NC(=O)NN(C)C)cccc2-3)c(C)s1 |
| InChI | InChI=1S/C19H19N5O2S/c1-9-8-12(10(2)27-9)17-15-16(21-22-17)11-6-5-7-13(14(11)18(15)25)20-19(26)23-24(3)4/h5-8H,1-4H3,(H,21,22)(H2,20,23,26) |
| InChIKey | DPXOFWIUQGYYOA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|