C13H13N5O2 — CID 54361052
3-amino-N',N'-dimethyl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carbohydrazide (PubChem CID 54361052) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-amino-N',N'-dimethyl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carbohydrazide.
| Compound Name | 3-amino-N',N'-dimethyl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 54361052 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-amino-N',N'-dimethyl-4-oxo-1H-indeno[2,1-d]pyrazole-5-carbohydrazide |
| SMILES | CN(C)NC(=O)c1cccc2c1C(=O)c1c(N)n[nH]c1-2 |
| InChI | InChI=1S/C13H13N5O2/c1-18(2)17-13(20)7-5-3-4-6-8(7)11(19)9-10(6)15-16-12(9)14/h3-5H,1-2H3,(H,17,20)(H3,14,15,16) |
| InChIKey | UMNCYVDQECPAFM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|