C17H15N5O2S — CID 5330024
1-(dimethylamino)-3-(4-oxo-3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea (PubChem CID 5330024) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(4-oxo-3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea.
| Compound Name | 1-(dimethylamino)-3-(4-oxo-3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea |
|---|---|
| PubChem CID | 5330024 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(dimethylamino)-3-(4-oxo-3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea |
| SMILES | CN(C)NC(=O)Nc1cccc2c1C(=O)c1c-2n[nH]c1-c1cccs1 |
| InChI | InChI=1S/C17H15N5O2S/c1-22(2)21-17(24)18-10-6-3-5-9-12(10)16(23)13-14(9)19-20-15(13)11-7-4-8-25-11/h3-8H,1-2H3,(H,19,20)(H2,18,21,24) |
| InChIKey | CNTHYULFGNYUTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|