C11H19N5 — CID 154150047
4-[3-(2,5-dihydropyrrol-1-yl)propyl]-1H-pyrimidine-2,4-diamine (PubChem CID 154150047) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-[3-(2,5-dihydropyrrol-1-yl)propyl]-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-[3-(2,5-dihydropyrrol-1-yl)propyl]-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154150047 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-[3-(2,5-dihydropyrrol-1-yl)propyl]-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CCCN2CC=CC2)C=CN1 |
| InChI | InChI=1S/C11H19N5/c12-10-14-6-5-11(13,15-10)4-3-9-16-7-1-2-8-16/h1-2,5-6H,3-4,7-9,13H2,(H3,12,14,15) |
| InChIKey | QZXLXZLHBDXQGA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|