About 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine
4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine (PubChem CID 154253562) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine |
| PubChem CID | 154253562 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CC2CCCN2)C=CN1 |
| InChI | InChI=1S/C9H17N5/c10-8-13-5-3-9(11,14-8)6-7-2-1-4-12-7/h3,5,7,12H,1-2,4,6,11H2,(H3,10,13,14) |
| InChIKey | DFXRDFHLOICLSF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine?
The IUPAC name of 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine (CID 154253562) is 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine is NC1=NC(N)(CC2CCCN2)C=CN1.
What is the InChIKey of 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine?
The InChIKey is DFXRDFHLOICLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c10-8-13-5-3-9(11,14-8)6-7-2-1-4-12-7/h3,5,7,12H,1-2,4,6,11H2,(H3,10,13,14).
What are the key properties of 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine?
4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine has a molecular weight of 195.27 g/mol, XLogP of -0.78, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pyrrolidin-2-ylmethyl)-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 154253562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).