About chloromethyl 2-chloroethanesulfinate
chloromethyl 2-chloroethanesulfinate (PubChem CID 154154793) has the molecular formula C3H6Cl2O2S
and a molecular weight of 177.05 g/mol. Its IUPAC name is chloromethyl 2-chloroethanesulfinate.
Molecular Properties
| Compound Name | chloromethyl 2-chloroethanesulfinate |
| PubChem CID | 154154793 |
| Molecular Formula | C3H6Cl2O2S |
| Molecular Weight | 177.05 g/mol |
| Exact Mass | 175.95 |
| IUPAC Name | chloromethyl 2-chloroethanesulfinate |
| SMILES | O=S(CCCl)OCCl |
| InChI | InChI=1S/C3H6Cl2O2S/c4-1-2-8(6)7-3-5/h1-3H2 |
| InChIKey | NKRJYXRBFNKHHT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.05 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-chloroethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-chloroethanesulfinate?
The IUPAC name of chloromethyl 2-chloroethanesulfinate (CID 154154793) is chloromethyl 2-chloroethanesulfinate.
What is the SMILES notation for chloromethyl 2-chloroethanesulfinate?
The canonical SMILES for chloromethyl 2-chloroethanesulfinate is O=S(CCCl)OCCl.
What is the InChIKey of chloromethyl 2-chloroethanesulfinate?
The InChIKey is NKRJYXRBFNKHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2O2S/c4-1-2-8(6)7-3-5/h1-3H2.
What are the key properties of chloromethyl 2-chloroethanesulfinate?
chloromethyl 2-chloroethanesulfinate has a molecular weight of 177.05 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-chloroethanesulfinate is sourced from PubChem (CID 154154793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).