C8H8Cl3NO — CID 154157702
2-(2,3,4-trichloroanilino)ethanol (PubChem CID 154157702) has the molecular formula C8H8Cl3NO and a molecular weight of 240.52 g/mol. Its IUPAC name is 2-(2,3,4-trichloroanilino)ethanol.
| Compound Name | 2-(2,3,4-trichloroanilino)ethanol |
|---|---|
| PubChem CID | 154157702 |
| Molecular Formula | C8H8Cl3NO |
| Molecular Weight | 240.52 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 2-(2,3,4-trichloroanilino)ethanol |
| SMILES | OCCNc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl3NO/c9-5-1-2-6(12-3-4-13)8(11)7(5)10/h1-2,12-13H,3-4H2 |
| InChIKey | KJUQUUDQRUTDHR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|