C23H35NO — CID 15415797
[(2S,3R)-1-benzyl-3-methylaziridin-2-yl]-dicyclohexylmethanol (PubChem CID 15415797) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is [(2S,3R)-1-benzyl-3-methylaziridin-2-yl]-dicyclohexylmethanol.
| Compound Name | [(2S,3R)-1-benzyl-3-methylaziridin-2-yl]-dicyclohexylmethanol |
|---|---|
| PubChem CID | 15415797 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | [(2S,3R)-1-benzyl-3-methylaziridin-2-yl]-dicyclohexylmethanol |
| SMILES | C[C@@H]1[C@@H](C(O)(C2CCCCC2)C2CCCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO/c1-18-22(24(18)17-19-11-5-2-6-12-19)23(25,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2,5-6,11-12,18,20-22,25H,3-4,7-10,13-17H2,1H3/t18-,22+,24?/m1/s1 |
| InChIKey | BHLNVFPLHHXCBQ-NCNUNHDVSA-N |
| XLogP | 5.15 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|