C10H10N2 — CID 154159269
6H-pyrido[1,2-a][1,5]diazocine (PubChem CID 154159269) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 6H-pyrido[1,2-a][1,5]diazocine.
| Compound Name | 6H-pyrido[1,2-a][1,5]diazocine |
|---|---|
| PubChem CID | 154159269 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 6H-pyrido[1,2-a][1,5]diazocine |
| SMILES | C1=CC2=C/C=N\C=CCN2C=C1 |
| InChI | InChI=1S/C10H10N2/c1-2-8-12-9-3-6-11-7-5-10(12)4-1/h1-8H,9H2/b6-3?,10-5?,11-7- |
| InChIKey | ZZRXFAVRQBIMHW-IQVVYLBUSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |