C9H8O4 — CID 154160026
3-(2-methyl-3H-furan-2-yl)furan-2,5-dione (PubChem CID 154160026) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 3-(2-methyl-3H-furan-2-yl)furan-2,5-dione.
| Compound Name | 3-(2-methyl-3H-furan-2-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 154160026 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-(2-methyl-3H-furan-2-yl)furan-2,5-dione |
| SMILES | CC1(C2=CC(=O)OC2=O)CC=CO1 |
| InChI | InChI=1S/C9H8O4/c1-9(3-2-4-12-9)6-5-7(10)13-8(6)11/h2,4-5H,3H2,1H3 |
| InChIKey | ITZTUPJMZFISSL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|