C23H23NO2S — CID 154166964
ethyl 2-amino-5,7-diphenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 154166964) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is ethyl 2-amino-5,7-diphenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5,7-diphenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 154166964 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl 2-amino-5,7-diphenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CC(c1ccccc1)CC2c1ccccc1 |
| InChI | InChI=1S/C23H23NO2S/c1-2-26-23(25)20-19-14-17(15-9-5-3-6-10-15)13-18(21(19)27-22(20)24)16-11-7-4-8-12-16/h3-12,17-18H,2,13-14,24H2,1H3 |
| InChIKey | PHYCZMQZNDBIQR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|