C15H20N2O4S — CID 68909950
diethyl 4-amino-3-thia-11-azatricyclo[6.2.1.02,6]undeca-2(6),4-diene-5,11-dicarboxylate (PubChem CID 68909950) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is diethyl 4-amino-3-thia-11-azatricyclo[6.2.1.02,6]undeca-2(6),4-diene-5,11-dicarboxylate.
| Compound Name | diethyl 4-amino-3-thia-11-azatricyclo[6.2.1.02,6]undeca-2(6),4-diene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 68909950 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | diethyl 4-amino-3-thia-11-azatricyclo[6.2.1.02,6]undeca-2(6),4-diene-5,11-dicarboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CC1CCC2N1C(=O)OCC |
| InChI | InChI=1S/C15H20N2O4S/c1-3-20-14(18)11-9-7-8-5-6-10(12(9)22-13(11)16)17(8)15(19)21-4-2/h8,10H,3-7,16H2,1-2H3 |
| InChIKey | ZGBSTOWNNJWERC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|