C12H17N2O2S+ — CID 3255603
ethyl 4-amino-3-thia-1-azoniatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate (PubChem CID 3255603) has the molecular formula C12H17N2O2S+ and a molecular weight of 253.35 g/mol. Its IUPAC name is ethyl 4-amino-3-thia-1-azoniatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate.
| Compound Name | ethyl 4-amino-3-thia-1-azoniatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate |
|---|---|
| PubChem CID | 3255603 |
| Molecular Formula | C12H17N2O2S+ |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | ethyl 4-amino-3-thia-1-azoniatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1C1CC[NH+]2CC1 |
| InChI | InChI=1S/C12H16N2O2S/c1-2-16-12(15)9-8-7-3-5-14(6-4-7)11(8)17-10(9)13/h7H,2-6,13H2,1H3/p+1 |
| InChIKey | VEEARKIVPVIRAK-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|