C24H29N7O2 — CID 154170540
N-[(2S)-3-methyl-1-oxo-1-[4-(tetrazol-1-yl)butylamino]pentan-2-yl]-9H-carbazole-3-carboxamide (PubChem CID 154170540) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-oxo-1-[4-(tetrazol-1-yl)butylamino]pentan-2-yl]-9H-carbazole-3-carboxamide.
| Compound Name | N-[(2S)-3-methyl-1-oxo-1-[4-(tetrazol-1-yl)butylamino]pentan-2-yl]-9H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 154170540 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-[4-(tetrazol-1-yl)butylamino]pentan-2-yl]-9H-carbazole-3-carboxamide |
| SMILES | CCC(C)[C@H](NC(=O)c1ccc2[nH]c3ccccc3c2c1)C(=O)NCCCCn1cnnn1 |
| InChI | InChI=1S/C24H29N7O2/c1-3-16(2)22(24(33)25-12-6-7-13-31-15-26-29-30-31)28-23(32)17-10-11-21-19(14-17)18-8-4-5-9-20(18)27-21/h4-5,8-11,14-16,22,27H,3,6-7,12-13H2,1-2H3,(H,25,33)(H,28,32)/t16?,22-/m0/s1 |
| InChIKey | XIOVGCLQXRRPLT-XLDIYJRPSA-N |
| XLogP | 3.05 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|