About N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide
N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide (PubChem CID 158196704) has the molecular formula C19H21N3OS
and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide |
| PubChem CID | 158196704 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc2[nH]c3ccccc3c2c1)C(N)=S |
| InChI | InChI=1S/C19H21N3OS/c1-3-11(2)17(18(20)24)22-19(23)12-8-9-16-14(10-12)13-6-4-5-7-15(13)21-16/h4-11,17,21H,3H2,1-2H3,(H2,20,24)(H,22,23)/t11-,17-/m0/s1 |
| InChIKey | GAKQLJACEXDONE-GTNSWQLSSA-N |
| XLogP | 3.75 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide?
The IUPAC name of N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide (CID 158196704) is N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide.
What is the SMILES notation for N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide?
The canonical SMILES for N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide is CC[C@H](C)[C@H](NC(=O)c1ccc2[nH]c3ccccc3c2c1)C(N)=S.
What is the InChIKey of N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide?
The InChIKey is GAKQLJACEXDONE-GTNSWQLSSA-N. The full InChI is InChI=1S/C19H21N3OS/c1-3-11(2)17(18(20)24)22-19(23)12-8-9-16-14(10-12)13-6-4-5-7-15(13)21-16/h4-11,17,21H,3H2,1-2H3,(H2,20,24)(H,22,23)/t11-,17-/m0/s1.
What are the key properties of N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide?
N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide has a molecular weight of 339.46 g/mol, XLogP of 3.75, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-1-amino-3-methyl-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide is sourced from PubChem (CID 158196704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).