C25H31N3O2S — CID 87200615
N-[(3S)-3-methyl-1-(oxan-4-ylmethylamino)-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide (PubChem CID 87200615) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is N-[(3S)-3-methyl-1-(oxan-4-ylmethylamino)-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide.
| Compound Name | N-[(3S)-3-methyl-1-(oxan-4-ylmethylamino)-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 87200615 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[(3S)-3-methyl-1-(oxan-4-ylmethylamino)-1-sulfanylidenepentan-2-yl]-9H-carbazole-3-carboxamide |
| SMILES | CC[C@H](C)C(NC(=O)c1ccc2[nH]c3ccccc3c2c1)C(=S)NCC1CCOCC1 |
| InChI | InChI=1S/C25H31N3O2S/c1-3-16(2)23(25(31)26-15-17-10-12-30-13-11-17)28-24(29)18-8-9-22-20(14-18)19-6-4-5-7-21(19)27-22/h4-9,14,16-17,23,27H,3,10-13,15H2,1-2H3,(H,26,31)(H,28,29)/t16-,23?/m0/s1 |
| InChIKey | AEICWHJETGGWIF-GZWBLTSWSA-N |
| XLogP | 4.81 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|