C19H21N3O2 — CID 67461997
N-[(3S)-1-amino-3-methyl-1-oxopentan-2-yl]-9H-carbazole-3-carboxamide (PubChem CID 67461997) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(3S)-1-amino-3-methyl-1-oxopentan-2-yl]-9H-carbazole-3-carboxamide.
| Compound Name | N-[(3S)-1-amino-3-methyl-1-oxopentan-2-yl]-9H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 67461997 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(3S)-1-amino-3-methyl-1-oxopentan-2-yl]-9H-carbazole-3-carboxamide |
| SMILES | CC[C@H](C)C(NC(=O)c1ccc2[nH]c3ccccc3c2c1)C(N)=O |
| InChI | InChI=1S/C19H21N3O2/c1-3-11(2)17(18(20)23)22-19(24)12-8-9-16-14(10-12)13-6-4-5-7-15(13)21-16/h4-11,17,21H,3H2,1-2H3,(H2,20,23)(H,22,24)/t11-,17?/m0/s1 |
| InChIKey | KXJBJROWIFINDM-PIJUOJQZSA-N |
| XLogP | 2.95 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |