C18H18O3S — CID 15417456
(2E)-2-(benzenesulfonylmethylidene)-5-benzyloxolane (PubChem CID 15417456) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2E)-2-(benzenesulfonylmethylidene)-5-benzyloxolane.
| Compound Name | (2E)-2-(benzenesulfonylmethylidene)-5-benzyloxolane |
|---|---|
| PubChem CID | 15417456 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2E)-2-(benzenesulfonylmethylidene)-5-benzyloxolane |
| SMILES | O=S(=O)(/C=C1\CCC(Cc2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C18H18O3S/c19-22(20,18-9-5-2-6-10-18)14-17-12-11-16(21-17)13-15-7-3-1-4-8-15/h1-10,14,16H,11-13H2/b17-14+ |
| InChIKey | TWXYRQLUPCCVQY-SAPNQHFASA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |