About 10-phenyldodecyl dihydrogen phosphite
10-phenyldodecyl dihydrogen phosphite (PubChem CID 154182802) has the molecular formula C18H31O3P
and a molecular weight of 326.42 g/mol. Its IUPAC name is 10-phenyldodecyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 10-phenyldodecyl dihydrogen phosphite |
| PubChem CID | 154182802 |
| Molecular Formula | C18H31O3P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 10-phenyldodecyl dihydrogen phosphite |
| SMILES | CCC(CCCCCCCCCOP(O)O)c1ccccc1 |
| InChI | InChI=1S/C18H31O3P/c1-2-17(18-14-10-8-11-15-18)13-9-6-4-3-5-7-12-16-21-22(19)20/h8,10-11,14-15,17,19-20H,2-7,9,12-13,16H2,1H3 |
| InChIKey | SYYQAXYDWSGCSF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10-phenyldodecyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phenyldodecyl dihydrogen phosphite?
The IUPAC name of 10-phenyldodecyl dihydrogen phosphite (CID 154182802) is 10-phenyldodecyl dihydrogen phosphite.
What is the SMILES notation for 10-phenyldodecyl dihydrogen phosphite?
The canonical SMILES for 10-phenyldodecyl dihydrogen phosphite is CCC(CCCCCCCCCOP(O)O)c1ccccc1.
What is the InChIKey of 10-phenyldodecyl dihydrogen phosphite?
The InChIKey is SYYQAXYDWSGCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31O3P/c1-2-17(18-14-10-8-11-15-18)13-9-6-4-3-5-7-12-16-21-22(19)20/h8,10-11,14-15,17,19-20H,2-7,9,12-13,16H2,1H3.
What are the key properties of 10-phenyldodecyl dihydrogen phosphite?
10-phenyldodecyl dihydrogen phosphite has a molecular weight of 326.42 g/mol, XLogP of 5.53, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phenyldodecyl dihydrogen phosphite is sourced from PubChem (CID 154182802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).