C6H14O3S2 — CID 154193686
3-(1-hydroxypropan-2-yloxy)-1,1-bis(sulfanyl)propan-2-ol (PubChem CID 154193686) has the molecular formula C6H14O3S2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-(1-hydroxypropan-2-yloxy)-1,1-bis(sulfanyl)propan-2-ol.
| Compound Name | 3-(1-hydroxypropan-2-yloxy)-1,1-bis(sulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 154193686 |
| Molecular Formula | C6H14O3S2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-(1-hydroxypropan-2-yloxy)-1,1-bis(sulfanyl)propan-2-ol |
| SMILES | CC(CO)OCC(O)C(S)S |
| InChI | InChI=1S/C6H14O3S2/c1-4(2-7)9-3-5(8)6(10)11/h4-8,10-11H,2-3H2,1H3 |
| InChIKey | MYYWHINFCCAANL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|