C11H6F6N2 — CID 154194608
3-[2,6-bis(trifluoromethyl)phenyl]-3-iminopropanenitrile (PubChem CID 154194608) has the molecular formula C11H6F6N2 and a molecular weight of 280.17 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]-3-iminopropanenitrile.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]-3-iminopropanenitrile |
|---|---|
| PubChem CID | 154194608 |
| Molecular Formula | C11H6F6N2 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]-3-iminopropanenitrile |
| SMILES | [H]/N=C(\CC#N)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H6F6N2/c12-10(13,14)6-2-1-3-7(11(15,16)17)9(6)8(19)4-5-18/h1-3,19H,4H2/b19-8+ |
| InChIKey | DYBQFGUAMSZRKG-UFWORHAWSA-N |
| XLogP | 4.01 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|