C29H28FN7O4S2 — CID 154196842
O-[[1-amino-4-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(1H-imidazol-2-yl)-1-benzofuran-6-yl]-methylsulfonylamino]butylidene]amino] imidazole-1-carbothioate (PubChem CID 154196842) has the molecular formula C29H28FN7O4S2 and a molecular weight of 621.72 g/mol. Its IUPAC name is O-[[1-amino-4-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(1H-imidazol-2-yl)-1-benzofuran-6-yl]-methylsulfonylamino]butylidene]amino] imidazole-1-carbothioate.
| Compound Name | O-[[1-amino-4-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(1H-imidazol-2-yl)-1-benzofuran-6-yl]-methylsulfonylamino]butylidene]amino] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 154196842 |
| Molecular Formula | C29H28FN7O4S2 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | O-[[1-amino-4-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(1H-imidazol-2-yl)-1-benzofuran-6-yl]-methylsulfonylamino]butylidene]amino] imidazole-1-carbothioate |
| SMILES | CS(=O)(=O)N(CCCC(N)=NOC(=S)n1ccnc1)c1cc2oc(-c3ccc(F)cc3)c(-c3ncc[nH]3)c2cc1C1CC1 |
| InChI | InChI=1S/C29H28FN7O4S2/c1-43(38,39)37(13-2-3-25(31)35-41-29(42)36-14-12-32-17-36)23-16-24-22(15-21(23)18-4-5-18)26(28-33-10-11-34-28)27(40-24)19-6-8-20(30)9-7-19/h6-12,14-18H,2-5,13H2,1H3,(H2,31,35)(H,33,34) |
| InChIKey | WOMNSHVZEUDBOZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|