C21H16 — CID 15419867
pentacyclo[13.2.2.29,12.02,8.04,6]henicosa-1(17),2(8),3,6,9(21),10,12(20),15,18-nonaene (PubChem CID 15419867) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is pentacyclo[13.2.2.29,12.02,8.04,6]henicosa-1(17),2(8),3,6,9(21),10,12(20),15,18-nonaene.
| Compound Name | pentacyclo[13.2.2.29,12.02,8.04,6]henicosa-1(17),2(8),3,6,9(21),10,12(20),15,18-nonaene |
|---|---|
| PubChem CID | 15419867 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | pentacyclo[13.2.2.29,12.02,8.04,6]henicosa-1(17),2(8),3,6,9(21),10,12(20),15,18-nonaene |
| SMILES | c1cc2ccc1CCc1ccc(cc1)-c1cc3c(cc1-2)C3 |
| InChI | InChI=1S/C21H16/c1-2-15-5-9-17(10-6-15)21-13-19-11-18(19)12-20(21)16-7-3-14(1)4-8-16/h3-10,12-13H,1-2,11H2 |
| InChIKey | CRJJLLWOWWBFLU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |