C10H13Cl2NO4S2 — CID 154207935
4-amino-6-butylbenzene-1,3-disulfonyl chloride (PubChem CID 154207935) has the molecular formula C10H13Cl2NO4S2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 4-amino-6-butylbenzene-1,3-disulfonyl chloride.
| Compound Name | 4-amino-6-butylbenzene-1,3-disulfonyl chloride |
|---|---|
| PubChem CID | 154207935 |
| Molecular Formula | C10H13Cl2NO4S2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 4-amino-6-butylbenzene-1,3-disulfonyl chloride |
| SMILES | CCCCc1cc(N)c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H13Cl2NO4S2/c1-2-3-4-7-5-8(13)10(19(12,16)17)6-9(7)18(11,14)15/h5-6H,2-4,13H2,1H3 |
| InChIKey | GNWMOHATRIOYCT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|