C24H20Cl2N6O3 — CID 15420884
(1E,3Z)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitro-N-phenylbuta-1,3-diene-1,4-diamine (PubChem CID 15420884) has the molecular formula C24H20Cl2N6O3 and a molecular weight of 511.37 g/mol. Its IUPAC name is (1E,3Z)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitro-N-phenylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitro-N-phenylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 15420884 |
| Molecular Formula | C24H20Cl2N6O3 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | (1E,3Z)-4-(benzotriazol-1-yl)-1,2-dichloro-N'-(4-ethoxyphenyl)-3-nitro-N-phenylbuta-1,3-diene-1,4-diamine |
| SMILES | CCOc1ccc(N/C(=C(C(\Cl)=C(/Cl)Nc2ccccc2)/[N+](=O)[O-])n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C24H20Cl2N6O3/c1-2-35-18-14-12-17(13-15-18)28-24(31-20-11-7-6-10-19(20)29-30-31)22(32(33)34)21(25)23(26)27-16-8-4-3-5-9-16/h3-15,27-28H,2H2,1H3/b23-21-,24-22- |
| InChIKey | UIFQQYNVFNLUKJ-SXAUZNKPSA-N |
| XLogP | 6.10 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|