C18H14Cl3N5O4 — CID 98467471
N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-3,4-dimethoxyaniline (PubChem CID 98467471) has the molecular formula C18H14Cl3N5O4 and a molecular weight of 470.70 g/mol. Its IUPAC name is N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-3,4-dimethoxyaniline.
| Compound Name | N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 98467471 |
| Molecular Formula | C18H14Cl3N5O4 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | N-[(1Z)-1-(benzotriazol-1-yl)-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(N/C(=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-])n2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C18H14Cl3N5O4/c1-29-13-8-7-10(9-14(13)30-2)22-18(16(26(27)28)15(19)17(20)21)25-12-6-4-3-5-11(12)23-24-25/h3-9,22H,1-2H3/b18-16- |
| InChIKey | MJDIHVWUVZJUMO-VLGSPTGOSA-N |
| XLogP | 4.85 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|